C25H55N3 — CID 155130615
6-(3-amino-2,2-dimethylpropyl)-2,4,4,8,8,10-hexamethyl-6-propylundecane-2,10-diamine (PubChem CID 155130615) has the molecular formula C25H55N3 and a molecular weight of 397.74 g/mol. Its IUPAC name is 6-(3-amino-2,2-dimethylpropyl)-2,4,4,8,8,10-hexamethyl-6-propylundecane-2,10-diamine.
| Compound Name | 6-(3-amino-2,2-dimethylpropyl)-2,4,4,8,8,10-hexamethyl-6-propylundecane-2,10-diamine |
|---|---|
| PubChem CID | 155130615 |
| Molecular Formula | C25H55N3 |
| Molecular Weight | 397.74 g/mol |
| Exact Mass | 397.44 |
| IUPAC Name | 6-(3-amino-2,2-dimethylpropyl)-2,4,4,8,8,10-hexamethyl-6-propylundecane-2,10-diamine |
| SMILES | CCCC(CC(C)(C)CN)(CC(C)(C)CC(C)(C)N)CC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C25H55N3/c1-12-13-25(18-22(6,7)19-26,16-20(2,3)14-23(8,9)27)17-21(4,5)15-24(10,11)28/h12-19,26-28H2,1-11H3 |
| InChIKey | CLYRLDRHGFUUGM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.74 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |