C22H47N — CID 90836053
2,4,4,6,6,8,8,10,10-nonamethyltridecan-2-amine (PubChem CID 90836053) has the molecular formula C22H47N and a molecular weight of 325.63 g/mol. Its IUPAC name is 2,4,4,6,6,8,8,10,10-nonamethyltridecan-2-amine.
| Compound Name | 2,4,4,6,6,8,8,10,10-nonamethyltridecan-2-amine |
|---|---|
| PubChem CID | 90836053 |
| Molecular Formula | C22H47N |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 325.37 |
| IUPAC Name | 2,4,4,6,6,8,8,10,10-nonamethyltridecan-2-amine |
| SMILES | CCCC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C22H47N/c1-12-13-18(2,3)14-19(4,5)15-20(6,7)16-21(8,9)17-22(10,11)23/h12-17,23H2,1-11H3 |
| InChIKey | JIWDQNWYXPZPHP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |