C13H29NO — CID 137447361
2,4-dimethyl-4-(2-methylpentan-2-yloxy)pentan-2-amine (PubChem CID 137447361) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is 2,4-dimethyl-4-(2-methylpentan-2-yloxy)pentan-2-amine.
| Compound Name | 2,4-dimethyl-4-(2-methylpentan-2-yloxy)pentan-2-amine |
|---|---|
| PubChem CID | 137447361 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 2,4-dimethyl-4-(2-methylpentan-2-yloxy)pentan-2-amine |
| SMILES | CCCC(C)(C)OC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C13H29NO/c1-8-9-12(4,5)15-13(6,7)10-11(2,3)14/h8-10,14H2,1-7H3 |
| InChIKey | SYKRUBWIBMVYBF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |