C13H27ClO — CID 129235543
1-chloro-3,5-dimethyl-5-[(2-methylpropan-2-yl)oxy]heptane (PubChem CID 129235543) has the molecular formula C13H27ClO and a molecular weight of 234.81 g/mol. Its IUPAC name is 1-chloro-3,5-dimethyl-5-[(2-methylpropan-2-yl)oxy]heptane.
| Compound Name | 1-chloro-3,5-dimethyl-5-[(2-methylpropan-2-yl)oxy]heptane |
|---|---|
| PubChem CID | 129235543 |
| Molecular Formula | C13H27ClO |
| Molecular Weight | 234.81 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-chloro-3,5-dimethyl-5-[(2-methylpropan-2-yl)oxy]heptane |
| SMILES | CCC(C)(CC(C)CCCl)OC(C)(C)C |
| InChI | InChI=1S/C13H27ClO/c1-7-13(6,15-12(3,4)5)10-11(2)8-9-14/h11H,7-10H2,1-6H3 |
| InChIKey | ATBMHEVYIQSTSK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|