C23H33FN6O2 — CID 175628678
ethyl (6R)-6-[4-[3-(1-amino-3-methyliminoprop-1-en-2-yl)-6-fluoro-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate (PubChem CID 175628678) has the molecular formula C23H33FN6O2 and a molecular weight of 444.56 g/mol. Its IUPAC name is ethyl (6R)-6-[4-[3-(1-amino-3-methyliminoprop-1-en-2-yl)-6-fluoro-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate.
| Compound Name | ethyl (6R)-6-[4-[3-(1-amino-3-methyliminoprop-1-en-2-yl)-6-fluoro-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 175628678 |
| Molecular Formula | C23H33FN6O2 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | ethyl (6R)-6-[4-[3-(1-amino-3-methyliminoprop-1-en-2-yl)-6-fluoro-2-pyridinyl]piperazin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate |
| SMILES | CCOC(=O)N1CC2(CC[C@@H](N3CCN(c4nc(F)ccc4C(=CN)/C=N/C)CC3)C2)C1 |
| InChI | InChI=1S/C23H33FN6O2/c1-3-32-22(31)30-15-23(16-30)7-6-18(12-23)28-8-10-29(11-9-28)21-19(4-5-20(24)27-21)17(13-25)14-26-2/h4-5,13-14,18H,3,6-12,15-16,25H2,1-2H3/b17-13?,26-14+/t18-/m1/s1 |
| InChIKey | SQHCPQWKJUXINO-XZSXSJEBSA-N |
| XLogP | 2.35 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|