C22H25N3 — CID 175630107
4-N,4-N-diethyl-1-N-methyl-1-N-(4-pyridin-2-ylphenyl)benzene-1,4-diamine (PubChem CID 175630107) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-methyl-1-N-(4-pyridin-2-ylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-methyl-1-N-(4-pyridin-2-ylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 175630107 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-methyl-1-N-(4-pyridin-2-ylphenyl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(N(C)c2ccc(-c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C22H25N3/c1-4-25(5-2)21-15-13-20(14-16-21)24(3)19-11-9-18(10-12-19)22-8-6-7-17-23-22/h6-17H,4-5H2,1-3H3 |
| InChIKey | NNUUOQOKTJUDFJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|