C14H27IN2 — CID 175630574
N-(3,3-dimethylbut-1-en-2-yl)-N'-(2-iodopropan-2-yl)-2,2-dimethylpropanimidamide (PubChem CID 175630574) has the molecular formula C14H27IN2 and a molecular weight of 350.29 g/mol. Its IUPAC name is N-(3,3-dimethylbut-1-en-2-yl)-N'-(2-iodopropan-2-yl)-2,2-dimethylpropanimidamide.
| Compound Name | N-(3,3-dimethylbut-1-en-2-yl)-N'-(2-iodopropan-2-yl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 175630574 |
| Molecular Formula | C14H27IN2 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(3,3-dimethylbut-1-en-2-yl)-N'-(2-iodopropan-2-yl)-2,2-dimethylpropanimidamide |
| SMILES | C=C(NC(=NC(C)(C)I)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H27IN2/c1-10(12(2,3)4)16-11(13(5,6)7)17-14(8,9)15/h1H2,2-9H3,(H,16,17) |
| InChIKey | UFDXSBYMMQJLFR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|