C53H39N5 — CID 175635549
2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3,4,7,8-tetramethyl-9-naphthalen-1-yl-1,10-phenanthroline (PubChem CID 175635549) has the molecular formula C53H39N5 and a molecular weight of 745.93 g/mol. Its IUPAC name is 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3,4,7,8-tetramethyl-9-naphthalen-1-yl-1,10-phenanthroline.
| Compound Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3,4,7,8-tetramethyl-9-naphthalen-1-yl-1,10-phenanthroline |
|---|---|
| PubChem CID | 175635549 |
| Molecular Formula | C53H39N5 |
| Molecular Weight | 745.93 g/mol |
| Exact Mass | 745.32 |
| IUPAC Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3,4,7,8-tetramethyl-9-naphthalen-1-yl-1,10-phenanthroline |
| SMILES | Cc1c(-c2cccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)nc2c(ccc3c(C)c(C)c(-c4cccc5ccccc45)nc32)c1C |
| InChI | InChI=1S/C53H39N5/c1-32-34(3)47(54-49-43(32)28-29-44-33(2)35(4)48(55-50(44)49)46-27-15-21-36-16-11-12-26-45(36)46)41-24-13-22-39(30-41)40-23-14-25-42(31-40)53-57-51(37-17-7-5-8-18-37)56-52(58-53)38-19-9-6-10-20-38/h5-31H,1-4H3 |
| InChIKey | CSTGUIDNQLZQDX-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.93 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|