C12H14FNO3S — CID 175636606
[3-fluoro-4-(2-methylpropanoyloxy)phenyl]methylcarbamothioic S-acid (PubChem CID 175636606) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is [3-fluoro-4-(2-methylpropanoyloxy)phenyl]methylcarbamothioic S-acid.
| Compound Name | [3-fluoro-4-(2-methylpropanoyloxy)phenyl]methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 175636606 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | [3-fluoro-4-(2-methylpropanoyloxy)phenyl]methylcarbamothioic S-acid |
| SMILES | CC(C)C(=O)Oc1ccc(CNC(=O)S)cc1F |
| InChI | InChI=1S/C12H14FNO3S/c1-7(2)11(15)17-10-4-3-8(5-9(10)13)6-14-12(16)18/h3-5,7H,6H2,1-2H3,(H2,14,16,18) |
| InChIKey | QBHDQHNDWCWVLY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|