C15H23N5O2 — CID 175636918
N-[1-amino-2-(methylamino)ethyl]-2-oxo-2-(2-pyridin-4-ylpiperidin-1-yl)acetamide (PubChem CID 175636918) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[1-amino-2-(methylamino)ethyl]-2-oxo-2-(2-pyridin-4-ylpiperidin-1-yl)acetamide.
| Compound Name | N-[1-amino-2-(methylamino)ethyl]-2-oxo-2-(2-pyridin-4-ylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 175636918 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[1-amino-2-(methylamino)ethyl]-2-oxo-2-(2-pyridin-4-ylpiperidin-1-yl)acetamide |
| SMILES | CNCC(N)NC(=O)C(=O)N1CCCCC1c1ccncc1 |
| InChI | InChI=1S/C15H23N5O2/c1-17-10-13(16)19-14(21)15(22)20-9-3-2-4-12(20)11-5-7-18-8-6-11/h5-8,12-13,17H,2-4,9-10,16H2,1H3,(H,19,21) |
| InChIKey | OKMDJIOTWMSYLR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|