C17H24N2O3S — CID 97352110
[(2S)-1,1-dioxothian-2-yl]-[(2R)-2-pyridin-4-ylazepan-1-yl]methanone (PubChem CID 97352110) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is [(2S)-1,1-dioxothian-2-yl]-[(2R)-2-pyridin-4-ylazepan-1-yl]methanone.
| Compound Name | [(2S)-1,1-dioxothian-2-yl]-[(2R)-2-pyridin-4-ylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 97352110 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [(2S)-1,1-dioxothian-2-yl]-[(2R)-2-pyridin-4-ylazepan-1-yl]methanone |
| SMILES | O=C([C@@H]1CCCCS1(=O)=O)N1CCCCC[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C17H24N2O3S/c20-17(16-7-3-5-13-23(16,21)22)19-12-4-1-2-6-15(19)14-8-10-18-11-9-14/h8-11,15-16H,1-7,12-13H2/t15-,16+/m1/s1 |
| InChIKey | WFMAHBILHJGHLL-CVEARBPZSA-N |
| XLogP | 2.49 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |