C19H18F4N4O2 — CID 175637335
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3,4-difluorophenyl)-4,4-difluoropiperidin-1-yl]-2-oxoacetamide (PubChem CID 175637335) has the molecular formula C19H18F4N4O2 and a molecular weight of 410.37 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3,4-difluorophenyl)-4,4-difluoropiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3,4-difluorophenyl)-4,4-difluoropiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175637335 |
| Molecular Formula | C19H18F4N4O2 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3,4-difluorophenyl)-4,4-difluoropiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCC(F)(F)C[C@H]2c2ccc(F)c(F)c2)cnc1N |
| InChI | InChI=1S/C19H18F4N4O2/c1-10-6-12(9-25-16(10)24)26-17(28)18(29)27-5-4-19(22,23)8-15(27)11-2-3-13(20)14(21)7-11/h2-3,6-7,9,15H,4-5,8H2,1H3,(H2,24,25)(H,26,28)/t15-/m0/s1 |
| InChIKey | GYXKOGAJAMQTBC-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|