C19H20ClFN4O2 — CID 167033401
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3-chloro-4-fluorophenyl)piperidin-1-yl]-2-oxoacetamide (PubChem CID 167033401) has the molecular formula C19H20ClFN4O2 and a molecular weight of 390.85 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3-chloro-4-fluorophenyl)piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3-chloro-4-fluorophenyl)piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 167033401 |
| Molecular Formula | C19H20ClFN4O2 |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S)-2-(3-chloro-4-fluorophenyl)piperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCCC[C@H]2c2ccc(F)c(Cl)c2)cnc1N |
| InChI | InChI=1S/C19H20ClFN4O2/c1-11-8-13(10-23-17(11)22)24-18(26)19(27)25-7-3-2-4-16(25)12-5-6-15(21)14(20)9-12/h5-6,8-10,16H,2-4,7H2,1H3,(H2,22,23)(H,24,26)/t16-/m0/s1 |
| InChIKey | OIZXUWINXQXPKX-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|