C18H21N5O2 — CID 164750958
N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]acetamide (PubChem CID 164750958) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]acetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 164750958 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-oxo-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCCC[C@@H]2c2cccnc2)cnc1N |
| InChI | InChI=1S/C18H21N5O2/c1-12-9-14(11-21-16(12)19)22-17(24)18(25)23-8-3-2-6-15(23)13-5-4-7-20-10-13/h4-5,7,9-11,15H,2-3,6,8H2,1H3,(H2,19,21)(H,22,24)/t15-/m1/s1 |
| InChIKey | APKOFFMJWCYWKR-OAHLLOKOSA-N |
| XLogP | 2.06 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|