C20H26N6O4S — CID 167033183
N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S)-2-[6-(methanesulfonamido)-3-pyridinyl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 167033183) has the molecular formula C20H26N6O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S)-2-[6-(methanesulfonamido)-3-pyridinyl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S)-2-[6-(methanesulfonamido)-3-pyridinyl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 167033183 |
| Molecular Formula | C20H26N6O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2S)-2-[6-(methanesulfonamido)-3-pyridinyl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | CCc1cc(NC(=O)C(=O)N2CCCC[C@H]2c2ccc(NS(C)(=O)=O)nc2)cnc1N |
| InChI | InChI=1S/C20H26N6O4S/c1-3-13-10-15(12-23-18(13)21)24-19(27)20(28)26-9-5-4-6-16(26)14-7-8-17(22-11-14)25-31(2,29)30/h7-8,10-12,16H,3-6,9H2,1-2H3,(H2,21,23)(H,22,25)(H,24,27)/t16-/m0/s1 |
| InChIKey | DJZIEVZLOMZVNZ-INIZCTEOSA-N |
| XLogP | 1.68 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|