C17H19NO2 — CID 175637835
1-(6-ethynyl-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidin-2-one (PubChem CID 175637835) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(6-ethynyl-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidin-2-one.
| Compound Name | 1-(6-ethynyl-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 175637835 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(6-ethynyl-2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidin-2-one |
| SMILES | C#Cc1ccc2c(c1)C(N1CCCC1=O)CC(C)(C)O2 |
| InChI | InChI=1S/C17H19NO2/c1-4-12-7-8-15-13(10-12)14(11-17(2,3)20-15)18-9-5-6-16(18)19/h1,7-8,10,14H,5-6,9,11H2,2-3H3 |
| InChIKey | OXWGEZNQJYKDLD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|