C29H28N4O4 — CID 175637939
2-methoxyethyl 2-[2-[[6-(1-aminoisoquinolin-7-yl)-3-methyl-2-oxobenzimidazol-1-yl]methyl]phenyl]acetate (PubChem CID 175637939) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 2-methoxyethyl 2-[2-[[6-(1-aminoisoquinolin-7-yl)-3-methyl-2-oxobenzimidazol-1-yl]methyl]phenyl]acetate.
| Compound Name | 2-methoxyethyl 2-[2-[[6-(1-aminoisoquinolin-7-yl)-3-methyl-2-oxobenzimidazol-1-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 175637939 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-methoxyethyl 2-[2-[[6-(1-aminoisoquinolin-7-yl)-3-methyl-2-oxobenzimidazol-1-yl]methyl]phenyl]acetate |
| SMILES | COCCOC(=O)Cc1ccccc1Cn1c(=O)n(C)c2ccc(-c3ccc4ccnc(N)c4c3)cc21 |
| InChI | InChI=1S/C29H28N4O4/c1-32-25-10-9-22(21-8-7-19-11-12-31-28(30)24(19)15-21)16-26(25)33(29(32)35)18-23-6-4-3-5-20(23)17-27(34)37-14-13-36-2/h3-12,15-16H,13-14,17-18H2,1-2H3,(H2,30,31) |
| InChIKey | PXWDMGMVKUAHCP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|