C33H36N4O5 — CID 175636569
ethyl 2-[2-[[5-(1-aminoisoquinolin-7-yl)-1-propan-2-ylindazol-3-yl]methoxy]-4-(2-methoxyethoxy)phenyl]acetate (PubChem CID 175636569) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(1-aminoisoquinolin-7-yl)-1-propan-2-ylindazol-3-yl]methoxy]-4-(2-methoxyethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(1-aminoisoquinolin-7-yl)-1-propan-2-ylindazol-3-yl]methoxy]-4-(2-methoxyethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 175636569 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | ethyl 2-[2-[[5-(1-aminoisoquinolin-7-yl)-1-propan-2-ylindazol-3-yl]methoxy]-4-(2-methoxyethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OCCOC)cc1OCc1nn(C(C)C)c2ccc(-c3ccc4ccnc(N)c4c3)cc12 |
| InChI | InChI=1S/C33H36N4O5/c1-5-40-32(38)18-25-8-10-26(41-15-14-39-4)19-31(25)42-20-29-28-17-24(9-11-30(28)37(36-29)21(2)3)23-7-6-22-12-13-35-33(34)27(22)16-23/h6-13,16-17,19,21H,5,14-15,18,20H2,1-4H3,(H2,34,35) |
| InChIKey | UTWCCSQVIWTQBO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|