C28H31N5O4 — CID 170558793
ethyl 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170558793) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170558793 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | ethyl 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | [H]/N=C(\N)c1nccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)OCC)nn3C(C)C)c1OC |
| InChI | InChI=1S/C28H31N5O4/c1-5-36-25(34)15-19-8-6-7-9-24(19)37-16-22-21-14-18(10-11-23(21)33(32-22)17(2)3)20-12-13-31-26(28(29)30)27(20)35-4/h6-14,17H,5,15-16H2,1-4H3,(H3,29,30) |
| InChIKey | JSXJIPBBYMMQHS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|