C27H28N4O4 — CID 170559850
2-[2-[[5-(3-carbamimidoyl-4-methoxyphenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid (PubChem CID 170559850) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[2-[[5-(3-carbamimidoyl-4-methoxyphenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[5-(3-carbamimidoyl-4-methoxyphenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 170559850 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[2-[[5-(3-carbamimidoyl-4-methoxyphenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1cc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)O)nn3C(C)C)ccc1OC |
| InChI | InChI=1S/C27H28N4O4/c1-16(2)31-23-10-8-17(18-9-11-25(34-3)21(13-18)27(28)29)12-20(23)22(30-31)15-35-24-7-5-4-6-19(24)14-26(32)33/h4-13,16H,14-15H2,1-3H3,(H3,28,29)(H,32,33) |
| InChIKey | FGAQFBVIKNSNHL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|