C26H27N5O4 — CID 170559454
2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid (PubChem CID 170559454) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 170559454 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 2-[2-[[5-(2-carbamimidoyl-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1nccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)O)nn3C(C)C)c1OC |
| InChI | InChI=1S/C26H27N5O4/c1-15(2)31-21-9-8-16(18-10-11-29-24(26(27)28)25(18)34-3)12-19(21)20(30-31)14-35-22-7-5-4-6-17(22)13-23(32)33/h4-12,15H,13-14H2,1-3H3,(H3,27,28)(H,32,33) |
| InChIKey | URDPXCLQXFSSPR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|