C26H25FN4O3 — CID 170559153
2-[2-[[5-(3-carbamimidoyl-2-fluorophenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid (PubChem CID 170559153) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-[2-[[5-(3-carbamimidoyl-2-fluorophenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[5-(3-carbamimidoyl-2-fluorophenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 170559153 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[2-[[5-(3-carbamimidoyl-2-fluorophenyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1cccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)O)nn3C(C)C)c1F |
| InChI | InChI=1S/C26H25FN4O3/c1-15(2)31-22-11-10-16(18-7-5-8-19(25(18)27)26(28)29)12-20(22)21(30-31)14-34-23-9-4-3-6-17(23)13-24(32)33/h3-12,15H,13-14H2,1-2H3,(H3,28,29)(H,32,33) |
| InChIKey | MHJQUGRINALXEZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|