C28H29FN4O4 — CID 170559414
ethyl 2-[2-[[5-[2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559414) has the molecular formula C28H29FN4O4 and a molecular weight of 504.56 g/mol. Its IUPAC name is ethyl 2-[2-[[5-[2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-[2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559414 |
| Molecular Formula | C28H29FN4O4 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | ethyl 2-[2-[[5-[2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1nn(C(C)C)c2ccc(-c3cccc(/C(N)=N/O)c3F)cc12 |
| InChI | InChI=1S/C28H29FN4O4/c1-4-36-26(34)15-19-8-5-6-11-25(19)37-16-23-22-14-18(12-13-24(22)33(31-23)17(2)3)20-9-7-10-21(27(20)29)28(30)32-35/h5-14,17,35H,4,15-16H2,1-3H3,(H2,30,32) |
| InChIKey | FTUVXHGQFWYPIK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|