C28H28N4O4 — CID 171763098
ethyl 2-[2-[[5-(2-isocyano-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 171763098) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(2-isocyano-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(2-isocyano-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 171763098 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | ethyl 2-[2-[[5-(2-isocyano-3-methoxy-4-pyridinyl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | [C-]#[N+]c1nccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)OCC)nn3C(C)C)c1OC |
| InChI | InChI=1S/C28H28N4O4/c1-6-35-26(33)16-20-9-7-8-10-25(20)36-17-23-22-15-19(11-12-24(22)32(31-23)18(2)3)21-13-14-30-28(29-4)27(21)34-5/h7-15,18H,6,16-17H2,1-3,5H3 |
| InChIKey | QYDUSYIUKVUKDS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|