C31H31N3O3 — CID 170559404
ethyl 2-[2-[[5-(8-aminonaphthalen-2-yl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559404) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(8-aminonaphthalen-2-yl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(8-aminonaphthalen-2-yl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559404 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | ethyl 2-[2-[[5-(8-aminonaphthalen-2-yl)-1-propan-2-ylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1nn(C(C)C)c2ccc(-c3ccc4cccc(N)c4c3)cc12 |
| InChI | InChI=1S/C31H31N3O3/c1-4-36-31(35)18-24-8-5-6-11-30(24)37-19-28-26-17-23(14-15-29(26)34(33-28)20(2)3)22-13-12-21-9-7-10-27(32)25(21)16-22/h5-17,20H,4,18-19,32H2,1-3H3 |
| InChIKey | ULIAOTMLWNKGHD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|