C30H32N4O4 — CID 170558861
ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170558861) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170558861 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)OCC)nn3C2CCC2)c1OC |
| InChI | InChI=1S/C30H32N4O4/c1-3-37-28(35)17-20-8-4-5-13-27(20)38-18-25-24-16-19(14-15-26(24)34(33-25)21-9-6-10-21)22-11-7-12-23(30(31)32)29(22)36-2/h4-5,7-8,11-16,21H,3,6,9-10,17-18H2,1-2H3,(H3,31,32) |
| InChIKey | CKQVLTAKFMEEJP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|