C30H32N4O3 — CID 170559521
ethyl 2-[2-[[5-(3-carbamimidoylphenyl)-2-cyclopentylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559521) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(3-carbamimidoylphenyl)-2-cyclopentylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(3-carbamimidoylphenyl)-2-cyclopentylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559521 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | ethyl 2-[2-[[5-(3-carbamimidoylphenyl)-2-cyclopentylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(-c2ccc3nn(C4CCCC4)c(COc4ccccc4CC(=O)OCC)c3c2)c1 |
| InChI | InChI=1S/C30H32N4O3/c1-2-36-29(35)18-22-8-3-6-13-28(22)37-19-27-25-17-21(20-9-7-10-23(16-20)30(31)32)14-15-26(25)33-34(27)24-11-4-5-12-24/h3,6-10,13-17,24H,2,4-5,11-12,18-19H2,1H3,(H3,31,32) |
| InChIKey | JKFBLRZMLMIINM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|