C30H29N3O4 — CID 170559405
ethyl 2-[2-[[5-(3-cyano-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559405) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(3-cyano-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(3-cyano-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559405 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | ethyl 2-[2-[[5-(3-cyano-2-methoxyphenyl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1nn(C2CCC2)c2ccc(-c3cccc(C#N)c3OC)cc12 |
| InChI | InChI=1S/C30H29N3O4/c1-3-36-29(34)17-21-8-4-5-13-28(21)37-19-26-25-16-20(24-12-6-9-22(18-31)30(24)35-2)14-15-27(25)33(32-26)23-10-7-11-23/h4-6,8-9,12-16,23H,3,7,10-11,17,19H2,1-2H3 |
| InChIKey | NNLSOVXIDOMRPD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |