C28H27N3O4 — CID 175498343
2-[2-[[1-cyclopentyl-5-(3-formamidophenyl)indazol-3-yl]methoxy]phenyl]acetic acid (PubChem CID 175498343) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[2-[[1-cyclopentyl-5-(3-formamidophenyl)indazol-3-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[1-cyclopentyl-5-(3-formamidophenyl)indazol-3-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 175498343 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[2-[[1-cyclopentyl-5-(3-formamidophenyl)indazol-3-yl]methoxy]phenyl]acetic acid |
| SMILES | O=CNc1cccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)O)nn3C2CCCC2)c1 |
| InChI | InChI=1S/C28H27N3O4/c32-18-29-22-8-5-7-19(14-22)20-12-13-26-24(15-20)25(30-31(26)23-9-2-3-10-23)17-35-27-11-4-1-6-21(27)16-28(33)34/h1,4-8,11-15,18,23H,2-3,9-10,16-17H2,(H,29,32)(H,33,34) |
| InChIKey | CWMYOYBJFWBZAG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|