C29H31N3O5 — CID 175498768
ethyl 2-[2-[[5-(3-formamidophenyl)-1-propan-2-ylindazol-3-yl]methoxy]-4-methoxyphenyl]acetate (PubChem CID 175498768) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(3-formamidophenyl)-1-propan-2-ylindazol-3-yl]methoxy]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(3-formamidophenyl)-1-propan-2-ylindazol-3-yl]methoxy]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 175498768 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | ethyl 2-[2-[[5-(3-formamidophenyl)-1-propan-2-ylindazol-3-yl]methoxy]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)cc1OCc1nn(C(C)C)c2ccc(-c3cccc(NC=O)c3)cc12 |
| InChI | InChI=1S/C29H31N3O5/c1-5-36-29(34)15-22-9-11-24(35-4)16-28(22)37-17-26-25-14-21(10-12-27(25)32(31-26)19(2)3)20-7-6-8-23(13-20)30-18-33/h6-14,16,18-19H,5,15,17H2,1-4H3,(H,30,33) |
| InChIKey | BNVOSRBUECUSDJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|