C31H30N4O3 — CID 170559623
ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559623) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559623 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-cyclobutylindazol-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1nn(C2CCC2)c2ccc(-c3cccc4c(N)nccc34)cc12 |
| InChI | InChI=1S/C31H30N4O3/c1-2-37-30(36)18-21-7-3-4-12-29(21)38-19-27-26-17-20(13-14-28(26)35(34-27)22-8-5-9-22)23-10-6-11-25-24(23)15-16-33-31(25)32/h3-4,6-7,10-17,22H,2,5,8-9,18-19H2,1H3,(H2,32,33) |
| InChIKey | XZYSMOQUFVSHJE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |