C32H31N3O4 — CID 170558878
ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-(oxolan-3-yl)indol-3-yl]methoxy]phenyl]acetate (PubChem CID 170558878) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-(oxolan-3-yl)indol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-(oxolan-3-yl)indol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170558878 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | ethyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-1-(oxolan-3-yl)indol-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cn(C2CCOC2)c2ccc(-c3cccc4c(N)nccc34)cc12 |
| InChI | InChI=1S/C32H31N3O4/c1-2-38-31(36)17-22-6-3-4-9-30(22)39-19-23-18-35(24-13-15-37-20-24)29-11-10-21(16-28(23)29)25-7-5-8-27-26(25)12-14-34-32(27)33/h3-12,14,16,18,24H,2,13,15,17,19-20H2,1H3,(H2,33,34) |
| InChIKey | APQLTSOBMBXXRE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |