C28H24N2O4 — CID 170558971
ethyl 2-[2-[[2-(1-aminoisoquinolin-5-yl)-1-benzofuran-4-yl]methoxy]phenyl]acetate (PubChem CID 170558971) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(1-aminoisoquinolin-5-yl)-1-benzofuran-4-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[2-(1-aminoisoquinolin-5-yl)-1-benzofuran-4-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170558971 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | ethyl 2-[2-[[2-(1-aminoisoquinolin-5-yl)-1-benzofuran-4-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cccc2oc(-c3cccc4c(N)nccc34)cc12 |
| InChI | InChI=1S/C28H24N2O4/c1-2-32-27(31)15-18-7-3-4-11-24(18)33-17-19-8-5-12-25-23(19)16-26(34-25)21-9-6-10-22-20(21)13-14-30-28(22)29/h3-14,16H,2,15,17H2,1H3,(H2,29,30) |
| InChIKey | MIHWJYNGVZXOAX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |