C31H30N2O6 — CID 175638028
3-methoxypropyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-7-methoxy-1-benzofuran-3-yl]methoxy]phenyl]acetate (PubChem CID 175638028) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is 3-methoxypropyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-7-methoxy-1-benzofuran-3-yl]methoxy]phenyl]acetate.
| Compound Name | 3-methoxypropyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-7-methoxy-1-benzofuran-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 175638028 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 3-methoxypropyl 2-[2-[[5-(1-aminoisoquinolin-5-yl)-7-methoxy-1-benzofuran-3-yl]methoxy]phenyl]acetate |
| SMILES | COCCCOC(=O)Cc1ccccc1OCc1coc2c(OC)cc(-c3cccc4c(N)nccc34)cc12 |
| InChI | InChI=1S/C31H30N2O6/c1-35-13-6-14-37-29(34)17-20-7-3-4-10-27(20)38-18-22-19-39-30-26(22)15-21(16-28(30)36-2)23-8-5-9-25-24(23)11-12-33-31(25)32/h3-5,7-12,15-16,19H,6,13-14,17-18H2,1-2H3,(H2,32,33) |
| InChIKey | DYCMLQORBUUDRS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|