C31H34N4O4 — CID 170559463
ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-(cyclobutylmethyl)indazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559463) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-(cyclobutylmethyl)indazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-(cyclobutylmethyl)indazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559463 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | ethyl 2-[2-[[5-(3-carbamimidoyl-2-methoxyphenyl)-1-(cyclobutylmethyl)indazol-3-yl]methoxy]phenyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(-c2ccc3c(c2)c(COc2ccccc2CC(=O)OCC)nn3CC2CCC2)c1OC |
| InChI | InChI=1S/C31H34N4O4/c1-3-38-29(36)17-22-10-4-5-13-28(22)39-19-26-25-16-21(23-11-7-12-24(31(32)33)30(23)37-2)14-15-27(25)35(34-26)18-20-8-6-9-20/h4-5,7,10-16,20H,3,6,8-9,17-19H2,1-2H3,(H3,32,33) |
| InChIKey | VLAVKGDXKKGSPR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|