C23H27BN2O6 — CID 170559363
[2-cyclobutyl-3-[[2-(2-ethoxy-2-oxoethyl)phenoxy]methyl]-6-methoxyindazol-5-yl]boronic acid (PubChem CID 170559363) has the molecular formula C23H27BN2O6 and a molecular weight of 438.29 g/mol. Its IUPAC name is [2-cyclobutyl-3-[[2-(2-ethoxy-2-oxoethyl)phenoxy]methyl]-6-methoxyindazol-5-yl]boronic acid.
| Compound Name | [2-cyclobutyl-3-[[2-(2-ethoxy-2-oxoethyl)phenoxy]methyl]-6-methoxyindazol-5-yl]boronic acid |
|---|---|
| PubChem CID | 170559363 |
| Molecular Formula | C23H27BN2O6 |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [2-cyclobutyl-3-[[2-(2-ethoxy-2-oxoethyl)phenoxy]methyl]-6-methoxyindazol-5-yl]boronic acid |
| SMILES | CCOC(=O)Cc1ccccc1OCc1c2cc(B(O)O)c(OC)cc2nn1C1CCC1 |
| InChI | InChI=1S/C23H27BN2O6/c1-3-31-23(27)11-15-7-4-5-10-21(15)32-14-20-17-12-18(24(28)29)22(30-2)13-19(17)25-26(20)16-8-6-9-16/h4-5,7,10,12-13,16,28-29H,3,6,8-9,11,14H2,1-2H3 |
| InChIKey | JMBHRCPAAAASHG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|