C29H37BN2O6 — CID 170559178
ethyl 2-[2-[[2-cyclobutyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]phenyl]acetate (PubChem CID 170559178) has the molecular formula C29H37BN2O6 and a molecular weight of 520.44 g/mol. Its IUPAC name is ethyl 2-[2-[[2-cyclobutyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[2-cyclobutyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170559178 |
| Molecular Formula | C29H37BN2O6 |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | ethyl 2-[2-[[2-cyclobutyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1c2cc(B3OC(C)(C)C(C)(C)O3)c(OC)cc2nn1C1CCC1 |
| InChI | InChI=1S/C29H37BN2O6/c1-7-35-27(33)15-19-11-8-9-14-25(19)36-18-24-21-16-22(30-37-28(2,3)29(4,5)38-30)26(34-6)17-23(21)31-32(24)20-12-10-13-20/h8-9,11,14,16-17,20H,7,10,12-13,15,18H2,1-6H3 |
| InChIKey | DAKOGSJDUWOMNG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|