C27H29BO7 — CID 156725298
ethyl 2-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[2,3-g][1]benzofuran-3-yl]methoxy]phenyl]acetate (PubChem CID 156725298) has the molecular formula C27H29BO7 and a molecular weight of 476.33 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[2,3-g][1]benzofuran-3-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[2,3-g][1]benzofuran-3-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 156725298 |
| Molecular Formula | C27H29BO7 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | ethyl 2-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[2,3-g][1]benzofuran-3-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1coc2c1cc(B1OC(C)(C)C(C)(C)O1)c1occc12 |
| InChI | InChI=1S/C27H29BO7/c1-6-30-23(29)13-17-9-7-8-10-22(17)32-15-18-16-33-24-19-11-12-31-25(19)21(14-20(18)24)28-34-26(2,3)27(4,5)35-28/h7-12,14,16H,6,13,15H2,1-5H3 |
| InChIKey | IOTDDOBMMCHVBE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|