C28H35BN2O5 — CID 175636566
ethyl 2-[2-[[1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]-5-methylphenyl]acetate (PubChem CID 175636566) has the molecular formula C28H35BN2O5 and a molecular weight of 490.41 g/mol. Its IUPAC name is ethyl 2-[2-[[1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]-5-methylphenyl]acetate.
| Compound Name | ethyl 2-[2-[[1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]-5-methylphenyl]acetate |
|---|---|
| PubChem CID | 175636566 |
| Molecular Formula | C28H35BN2O5 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | ethyl 2-[2-[[1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methoxy]-5-methylphenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C)ccc1OCc1nn(C2CC2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C28H35BN2O5/c1-7-33-26(32)15-19-14-18(2)8-13-25(19)34-17-23-22-16-20(29-35-27(3,4)28(5,6)36-29)9-12-24(22)31(30-23)21-10-11-21/h8-9,12-14,16,21H,7,10-11,15,17H2,1-6H3 |
| InChIKey | PPMPJZNZDLNGKS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|