C18H26N4O3 — CID 175639146
5-[[2-oxo-2-[4-[(2R)-pentan-2-yl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide (PubChem CID 175639146) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-[[2-oxo-2-[4-[(2R)-pentan-2-yl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-oxo-2-[4-[(2R)-pentan-2-yl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175639146 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 5-[[2-oxo-2-[4-[(2R)-pentan-2-yl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide |
| SMILES | CCC[C@@H](C)C1CCN(C(=O)C(=O)Nc2cncc(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C18H26N4O3/c1-3-4-12(2)13-5-7-22(8-6-13)18(25)17(24)21-15-9-14(16(19)23)10-20-11-15/h9-13H,3-8H2,1-2H3,(H2,19,23)(H,21,24)/t12-/m1/s1 |
| InChIKey | RBIGXLHABAYDRL-GFCCVEGCSA-N |
| XLogP | 1.79 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|