C17H22N4O4 — CID 166022646
5-[[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 166022646) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-[[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166022646 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5-[[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(NC(=O)C(=O)N2CC[C@]3(O)CCCC[C@@H]3C2)c1 |
| InChI | InChI=1S/C17H22N4O4/c18-14(22)11-7-13(9-19-8-11)20-15(23)16(24)21-6-5-17(25)4-2-1-3-12(17)10-21/h7-9,12,25H,1-6,10H2,(H2,18,22)(H,20,23)/t12-,17-/m1/s1 |
| InChIKey | SDJWNPCFGKVYDD-SJKOYZFVSA-N |
| XLogP | 0.27 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|