C19H24F2N4O3 — CID 164750078
5-[[2-[2-(4,4-difluorocyclohexyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 164750078) has the molecular formula C19H24F2N4O3 and a molecular weight of 394.42 g/mol. Its IUPAC name is 5-[[2-[2-(4,4-difluorocyclohexyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[2-(4,4-difluorocyclohexyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164750078 |
| Molecular Formula | C19H24F2N4O3 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-[[2-[2-(4,4-difluorocyclohexyl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(NC(=O)C(=O)N2CCCCC2C2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C19H24F2N4O3/c20-19(21)6-4-12(5-7-19)15-3-1-2-8-25(15)18(28)17(27)24-14-9-13(16(22)26)10-23-11-14/h9-12,15H,1-8H2,(H2,22,26)(H,24,27) |
| InChIKey | ABJMMFKRYBCXBK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|