C22H22N6O3 — CID 167033243
5-[[2-oxo-2-[(2S)-2-[4-(1H-pyrazol-5-yl)phenyl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide (PubChem CID 167033243) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 5-[[2-oxo-2-[(2S)-2-[4-(1H-pyrazol-5-yl)phenyl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-oxo-2-[(2S)-2-[4-(1H-pyrazol-5-yl)phenyl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167033243 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 5-[[2-oxo-2-[(2S)-2-[4-(1H-pyrazol-5-yl)phenyl]piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(NC(=O)C(=O)N2CCCC[C@H]2c2ccc(-c3ccn[nH]3)cc2)c1 |
| InChI | InChI=1S/C22H22N6O3/c23-20(29)16-11-17(13-24-12-16)26-21(30)22(31)28-10-2-1-3-19(28)15-6-4-14(5-7-15)18-8-9-25-27-18/h4-9,11-13,19H,1-3,10H2,(H2,23,29)(H,25,27)(H,26,30)/t19-/m0/s1 |
| InChIKey | HTKDPCMSSZBRMC-IBGZPJMESA-N |
| XLogP | 2.26 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|