C19H21N5O5S — CID 167033299
5-[[2-oxo-2-[(2S)-2-(3-sulfamoylphenyl)piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide (PubChem CID 167033299) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is 5-[[2-oxo-2-[(2S)-2-(3-sulfamoylphenyl)piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-oxo-2-[(2S)-2-(3-sulfamoylphenyl)piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167033299 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-[[2-oxo-2-[(2S)-2-(3-sulfamoylphenyl)piperidin-1-yl]acetyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(NC(=O)C(=O)N2CCCC[C@H]2c2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C19H21N5O5S/c20-17(25)13-8-14(11-22-10-13)23-18(26)19(27)24-7-2-1-6-16(24)12-4-3-5-15(9-12)30(21,28)29/h3-5,8-11,16H,1-2,6-7H2,(H2,20,25)(H,23,26)(H2,21,28,29)/t16-/m0/s1 |
| InChIKey | KKGWQZOMCDTCEY-INIZCTEOSA-N |
| XLogP | 0.52 |
| TPSA | 165.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|