C20H26N4O — CID 175645232
(1R,9S)-4-(6-amino-3-pyridinyl)-11-(2-methylpropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175645232) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is (1R,9S)-4-(6-amino-3-pyridinyl)-11-(2-methylpropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-4-(6-amino-3-pyridinyl)-11-(2-methylpropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175645232 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R,9S)-4-(6-amino-3-pyridinyl)-11-(2-methylpropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CC(C)CN1C[C@@H]2C[C@H](C1)c1cc(-c3ccc(N)nc3)cc(=O)n1C2 |
| InChI | InChI=1S/C20H26N4O/c1-13(2)9-23-10-14-5-17(12-23)18-6-16(7-20(25)24(18)11-14)15-3-4-19(21)22-8-15/h3-4,6-8,13-14,17H,5,9-12H2,1-2H3,(H2,21,22)/t14-,17+/m0/s1 |
| InChIKey | JNZJCLNZBDATIE-WMLDXEAASA-N |
| XLogP | 2.57 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|