C21H27N3O — CID 175645158
(1R,9S)-11-(3-methylbutyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175645158) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (1R,9S)-11-(3-methylbutyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-(3-methylbutyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175645158 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (1R,9S)-11-(3-methylbutyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CC(C)CCN1C[C@@H]2C[C@H](C1)c1cc(-c3cccnc3)cc(=O)n1C2 |
| InChI | InChI=1S/C21H27N3O/c1-15(2)5-7-23-12-16-8-19(14-23)20-9-18(10-21(25)24(20)13-16)17-4-3-6-22-11-17/h3-4,6,9-11,15-16,19H,5,7-8,12-14H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | ZFPASYFVRNOQOP-QFBILLFUSA-N |
| XLogP | 3.38 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|