C23H24N4O — CID 175643360
(1R,9S)-4-pyridin-3-yl-11-(2-pyridin-3-ylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175643360) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is (1R,9S)-4-pyridin-3-yl-11-(2-pyridin-3-ylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-4-pyridin-3-yl-11-(2-pyridin-3-ylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175643360 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (1R,9S)-4-pyridin-3-yl-11-(2-pyridin-3-ylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cc(-c2cccnc2)cc2n1C[C@H]1C[C@@H]2CN(CCc2cccnc2)C1 |
| InChI | InChI=1S/C23H24N4O/c28-23-11-20(19-4-2-7-25-13-19)10-22-21-9-18(15-27(22)23)14-26(16-21)8-5-17-3-1-6-24-12-17/h1-4,6-7,10-13,18,21H,5,8-9,14-16H2/t18-,21+/m0/s1 |
| InChIKey | PVUAXNTXVOTVQY-GHTZIAJQSA-N |
| XLogP | 2.97 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|