C22H27N3O3 — CID 175645789
methyl 5-[(1R,9S)-6-oxo-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pentanoate (PubChem CID 175645789) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is methyl 5-[(1R,9S)-6-oxo-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pentanoate.
| Compound Name | methyl 5-[(1R,9S)-6-oxo-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pentanoate |
|---|---|
| PubChem CID | 175645789 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | methyl 5-[(1R,9S)-6-oxo-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C[C@@H]2C[C@H](C1)c1cc(-c3cccnc3)cc(=O)n1C2 |
| InChI | InChI=1S/C22H27N3O3/c1-28-22(27)6-2-3-8-24-13-16-9-19(15-24)20-10-18(11-21(26)25(20)14-16)17-5-4-7-23-12-17/h4-5,7,10-12,16,19H,2-3,6,8-9,13-15H2,1H3/t16-,19+/m0/s1 |
| InChIKey | BNBSXPLGFNOPEO-QFBILLFUSA-N |
| XLogP | 2.67 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|