C20H21F3N2O — CID 175641838
(1R,9S)-4-phenyl-11-(3,3,3-trifluoropropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175641838) has the molecular formula C20H21F3N2O and a molecular weight of 362.39 g/mol. Its IUPAC name is (1R,9S)-4-phenyl-11-(3,3,3-trifluoropropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-4-phenyl-11-(3,3,3-trifluoropropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175641838 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (1R,9S)-4-phenyl-11-(3,3,3-trifluoropropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cc(-c2ccccc2)cc2n1C[C@H]1C[C@@H]2CN(CCC(F)(F)F)C1 |
| InChI | InChI=1S/C20H21F3N2O/c21-20(22,23)6-7-24-11-14-8-17(13-24)18-9-16(10-19(26)25(18)12-14)15-4-2-1-3-5-15/h1-5,9-10,14,17H,6-8,11-13H2/t14-,17+/m0/s1 |
| InChIKey | FDLRYAOJPWOFLP-WMLDXEAASA-N |
| XLogP | 3.89 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |