C24H26N4O3 — CID 175643113
3-methyl-5-[2-[(1R,9S)-6-oxo-4-phenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 175643113) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-methyl-5-[2-[(1R,9S)-6-oxo-4-phenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-methyl-5-[2-[(1R,9S)-6-oxo-4-phenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175643113 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-methyl-5-[2-[(1R,9S)-6-oxo-4-phenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]cc(CCN2C[C@@H]3C[C@H](C2)c2cc(-c4ccccc4)cc(=O)n2C3)c1=O |
| InChI | InChI=1S/C24H26N4O3/c1-26-23(30)18(12-25-24(26)31)7-8-27-13-16-9-20(15-27)21-10-19(11-22(29)28(21)14-16)17-5-3-2-4-6-17/h2-6,10-12,16,20H,7-9,13-15H2,1H3,(H,25,31)/t16-,20+/m0/s1 |
| InChIKey | SYTFBSCEYWTWNV-OXJNMPFZSA-N |
| XLogP | 1.56 |
| TPSA | 80.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |